C19H28N2O5 — CID 16739134
[4-[(2S)-2,3-diamino-3-oxopropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate (PubChem CID 16739134) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate.
| Compound Name | [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 16739134 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1ccc(C[C@H](N)C(N)=O)cc1OC(=O)CC(C)C |
| InChI | InChI=1S/C19H28N2O5/c1-11(2)7-17(22)25-15-6-5-13(9-14(20)19(21)24)10-16(15)26-18(23)8-12(3)4/h5-6,10-12,14H,7-9,20H2,1-4H3,(H2,21,24)/t14-/m0/s1 |
| InChIKey | ORRAMFBCDBOAGB-AWEZNQCLSA-N |
| XLogP | 1.94 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|