C29H45NO8 — CID 90841555
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate (PubChem CID 90841555) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate |
|---|---|
| PubChem CID | 90841555 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)CC(C)C)c(OC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C29H45NO8/c1-9-19(6)14-28(33)35-20(7)21(8)36-29(34)23(30)15-22-10-11-24(37-26(31)12-17(2)3)25(16-22)38-27(32)13-18(4)5/h10-11,16-21,23H,9,12-15,30H2,1-8H3/t19?,20-,21-,23-/m0/s1 |
| InChIKey | JNJXGCILFIOCAN-AZJXCBEJSA-N |
| XLogP | 4.76 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|