C31H49NO8 — CID 90988845
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2-methylpentanoate (PubChem CID 90988845) has the molecular formula C31H49NO8 and a molecular weight of 563.73 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2-methylpentanoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2-methylpentanoate |
|---|---|
| PubChem CID | 90988845 |
| Molecular Formula | C31H49NO8 |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)CC(C)CC)c(OC(=O)CC(C)CC)c1 |
| InChI | InChI=1S/C31H49NO8/c1-9-12-21(6)30(35)37-22(7)23(8)38-31(36)25(32)17-24-13-14-26(39-28(33)15-19(4)10-2)27(18-24)40-29(34)16-20(5)11-3/h13-14,18-23,25H,9-12,15-17,32H2,1-8H3/t19?,20?,21?,22-,23-,25-/m0/s1 |
| InChIKey | AWNZXAYOGJQTAO-MLHDWPHVSA-N |
| XLogP | 5.54 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|