C22H31NO8 — CID 66950831
[(3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylbutanoate (PubChem CID 66950831) has the molecular formula C22H31NO8 and a molecular weight of 437.49 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylbutanoate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 66950831 |
| Molecular Formula | C22H31NO8 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C22H31NO8/c1-7-12(2)21(26)28-13(3)14(4)29-22(27)18(23)10-17-8-9-19(30-15(5)24)20(11-17)31-16(6)25/h8-9,11-14,18H,7,10,23H2,1-6H3/t12?,13?,14-,18-/m0/s1 |
| InChIKey | HNZJLYLOWODDFH-IXERNRAKSA-N |
| XLogP | 2.32 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|