C23H33NO8 — CID 91289025
[(2S,3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylpentanoate (PubChem CID 91289025) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylpentanoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylpentanoate |
|---|---|
| PubChem CID | 91289025 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-(3,4-diacetyloxyphenyl)propanoyl]oxybutan-2-yl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(C)=O)c(OC(C)=O)c1 |
| InChI | InChI=1S/C23H33NO8/c1-7-8-13(2)22(27)29-14(3)15(4)30-23(28)19(24)11-18-9-10-20(31-16(5)25)21(12-18)32-17(6)26/h9-10,12-15,19H,7-8,11,24H2,1-6H3/t13?,14-,15-,19-/m0/s1 |
| InChIKey | AGOAHOMLCSEJNZ-ARGWYZPISA-N |
| XLogP | 2.71 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|