C30H47NO9 — CID 91049067
[4-[(2S)-2-amino-3-[(2S,3S)-3-butoxycarbonyloxybutan-2-yl]oxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate (PubChem CID 91049067) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-[(2S,3S)-3-butoxycarbonyloxybutan-2-yl]oxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate.
| Compound Name | [4-[(2S)-2-amino-3-[(2S,3S)-3-butoxycarbonyloxybutan-2-yl]oxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate |
|---|---|
| PubChem CID | 91049067 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | [4-[(2S)-2-amino-3-[(2S,3S)-3-butoxycarbonyloxybutan-2-yl]oxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate |
| SMILES | CCCCOC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)C(C)CCC)c(OC(=O)C(C)CCC)c1 |
| InChI | InChI=1S/C30H47NO9/c1-8-11-16-36-30(35)38-22(7)21(6)37-29(34)24(31)17-23-14-15-25(39-27(32)19(4)12-9-2)26(18-23)40-28(33)20(5)13-10-3/h14-15,18-22,24H,8-13,16-17,31H2,1-7H3/t19?,20?,21-,22-,24-/m0/s1 |
| InChIKey | YZGOQWKWMZHQFQ-WMOILFFISA-N |
| XLogP | 5.51 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|