C30H45NO8 — CID 91071755
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate (PubChem CID 91071755) has the molecular formula C30H45NO8 and a molecular weight of 547.69 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91071755 |
| Molecular Formula | C30H45NO8 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.31 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
| SMILES | CCC(C)C(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)[C@H](C)OC(=O)C2CCCCC2)cc1OC(=O)C(C)CC |
| InChI | InChI=1S/C30H45NO8/c1-7-18(3)27(32)38-25-15-14-22(17-26(25)39-28(33)19(4)8-2)16-24(31)30(35)37-21(6)20(5)36-29(34)23-12-10-9-11-13-23/h14-15,17-21,23-24H,7-13,16,31H2,1-6H3/t18?,19?,20-,21-,24-/m0/s1 |
| InChIKey | HISZDBBAMLFIOS-YJXYETDXSA-N |
| XLogP | 4.90 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|