C32H49NO8 — CID 66951651
[(3S)-3-[(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate (PubChem CID 66951651) has the molecular formula C32H49NO8 and a molecular weight of 575.74 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66951651 |
| Molecular Formula | C32H49NO8 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(4-methylpentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
| SMILES | CC(C)CCC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)C(C)OC(=O)C2CCCCC2)cc1OC(=O)CCC(C)C |
| InChI | InChI=1S/C32H49NO8/c1-20(2)12-16-29(34)40-27-15-14-24(19-28(27)41-30(35)17-13-21(3)4)18-26(33)32(37)39-23(6)22(5)38-31(36)25-10-8-7-9-11-25/h14-15,19-23,25-26H,7-13,16-18,33H2,1-6H3/t22?,23-,26-/m0/s1 |
| InChIKey | YUQVAAPTVACARF-RGXIATLPSA-N |
| XLogP | 5.68 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|