C27H39NO8 — CID 66947157
[(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate (PubChem CID 66947157) has the molecular formula C27H39NO8 and a molecular weight of 505.61 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66947157 |
| Molecular Formula | C27H39NO8 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate |
| SMILES | CC(C)C(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)COC(=O)C2CCCCC2)cc1OC(=O)C(C)C |
| InChI | InChI=1S/C27H39NO8/c1-16(2)24(29)35-22-12-11-19(14-23(22)36-25(30)17(3)4)13-21(28)27(32)34-18(5)15-33-26(31)20-9-7-6-8-10-20/h11-12,14,16-18,20-21H,6-10,13,15,28H2,1-5H3/t18-,21-/m0/s1 |
| InChIKey | UGIZLFLGRZBOBB-RXVVDRJESA-N |
| XLogP | 3.73 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|