C29H43NO10 — CID 66945623
2-[(2S)-2-amino-3-[3-butan-2-yloxycarbonyloxy-4-[(2S)-butan-2-yl]oxycarbonyloxyphenyl]propanoyl]oxypropyl cyclohexanecarboxylate (PubChem CID 66945623) has the molecular formula C29H43NO10 and a molecular weight of 565.66 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-[3-butan-2-yloxycarbonyloxy-4-[(2S)-butan-2-yl]oxycarbonyloxyphenyl]propanoyl]oxypropyl cyclohexanecarboxylate.
| Compound Name | 2-[(2S)-2-amino-3-[3-butan-2-yloxycarbonyloxy-4-[(2S)-butan-2-yl]oxycarbonyloxyphenyl]propanoyl]oxypropyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66945623 |
| Molecular Formula | C29H43NO10 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 2-[(2S)-2-amino-3-[3-butan-2-yloxycarbonyloxy-4-[(2S)-butan-2-yl]oxycarbonyloxyphenyl]propanoyl]oxypropyl cyclohexanecarboxylate |
| SMILES | CCC(C)OC(=O)Oc1cc(C[C@H](N)C(=O)OC(C)COC(=O)C2CCCCC2)ccc1OC(=O)O[C@@H](C)CC |
| InChI | InChI=1S/C29H43NO10/c1-6-18(3)37-28(33)39-24-14-13-21(16-25(24)40-29(34)38-19(4)7-2)15-23(30)27(32)36-20(5)17-35-26(31)22-11-9-8-10-12-22/h13-14,16,18-20,22-23H,6-12,15,17,30H2,1-5H3/t18-,19?,20?,23-/m0/s1 |
| InChIKey | FQVGEMHFVKQFEX-VKDVSPNTSA-N |
| XLogP | 5.24 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|