C31H47NO10 — CID 66946417
2-[(2S)-2-amino-3-[4-[(2S)-3-methylbutan-2-yl]oxycarbonyloxy-3-(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropyl cyclohexanecarboxylate (PubChem CID 66946417) has the molecular formula C31H47NO10 and a molecular weight of 593.71 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-[4-[(2S)-3-methylbutan-2-yl]oxycarbonyloxy-3-(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropyl cyclohexanecarboxylate.
| Compound Name | 2-[(2S)-2-amino-3-[4-[(2S)-3-methylbutan-2-yl]oxycarbonyloxy-3-(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66946417 |
| Molecular Formula | C31H47NO10 |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.32 |
| IUPAC Name | 2-[(2S)-2-amino-3-[4-[(2S)-3-methylbutan-2-yl]oxycarbonyloxy-3-(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropyl cyclohexanecarboxylate |
| SMILES | CC(COC(=O)C1CCCCC1)OC(=O)[C@@H](N)Cc1ccc(OC(=O)O[C@@H](C)C(C)C)c(OC(=O)OC(C)C(C)C)c1 |
| InChI | InChI=1S/C31H47NO10/c1-18(2)21(6)39-30(35)41-26-14-13-23(16-27(26)42-31(36)40-22(7)19(3)4)15-25(32)29(34)38-20(5)17-37-28(33)24-11-9-8-10-12-24/h13-14,16,18-22,24-25H,8-12,15,17,32H2,1-7H3/t20?,21-,22?,25-/m0/s1 |
| InChIKey | NKJACJMVOVVBBR-SEEQCCGUSA-N |
| XLogP | 5.73 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|