C25H35NO8 — CID 66946513
[(2S)-2-[(2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate (PubChem CID 66946513) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66946513 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-di(propanoyloxy)phenyl]propanoyl]oxypropyl] cyclohexanecarboxylate |
| SMILES | CCC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)COC(=O)C2CCCCC2)cc1OC(=O)CC |
| InChI | InChI=1S/C25H35NO8/c1-4-22(27)33-20-12-11-17(14-21(20)34-23(28)5-2)13-19(26)25(30)32-16(3)15-31-24(29)18-9-7-6-8-10-18/h11-12,14,16,18-19H,4-10,13,15,26H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | YOTDDZXZZRMHFO-LPHOPBHVSA-N |
| XLogP | 3.24 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|