C32H49NO10 — CID 66949194
[(3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate (PubChem CID 66949194) has the molecular formula C32H49NO10 and a molecular weight of 607.74 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66949194 |
| Molecular Formula | C32H49NO10 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
| SMILES | CCC(C)COC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)C(C)OC(=O)C2CCCCC2)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C32H49NO10/c1-7-20(3)18-38-31(36)42-27-15-14-24(17-28(27)43-32(37)39-19-21(4)8-2)16-26(33)30(35)41-23(6)22(5)40-29(34)25-12-10-9-11-13-25/h14-15,17,20-23,25-26H,7-13,16,18-19,33H2,1-6H3/t20?,21?,22?,23-,26-/m0/s1 |
| InChIKey | ODPJPPJTPDQKMA-LAPMQGOMSA-N |
| XLogP | 6.12 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|