C28H41NO8 — CID 91440886
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate (PubChem CID 91440886) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91440886 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-di(butanoyloxy)phenyl]propanoyl]oxybutan-2-yl] cyclohexanecarboxylate |
| SMILES | CCCC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)[C@H](C)OC(=O)C2CCCCC2)cc1OC(=O)CCC |
| InChI | InChI=1S/C28H41NO8/c1-5-10-25(30)36-23-15-14-20(17-24(23)37-26(31)11-6-2)16-22(29)28(33)35-19(4)18(3)34-27(32)21-12-8-7-9-13-21/h14-15,17-19,21-22H,5-13,16,29H2,1-4H3/t18-,19-,22-/m0/s1 |
| InChIKey | DOVWLYLTCWHESK-IPJJNNNSSA-N |
| XLogP | 4.41 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|