C28H43NO8 — CID 91281234
[4-[(2S)-2-amino-3-oxo-3-[(2S,3S)-3-propanoyloxybutan-2-yl]oxypropyl]-2-hexanoyloxyphenyl] hexanoate (PubChem CID 91281234) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-[(2S,3S)-3-propanoyloxybutan-2-yl]oxypropyl]-2-hexanoyloxyphenyl] hexanoate.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-[(2S,3S)-3-propanoyloxybutan-2-yl]oxypropyl]-2-hexanoyloxyphenyl] hexanoate |
|---|---|
| PubChem CID | 91281234 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-[(2S,3S)-3-propanoyloxybutan-2-yl]oxypropyl]-2-hexanoyloxyphenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)[C@H](C)OC(=O)CC)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C28H43NO8/c1-6-9-11-13-26(31)36-23-16-15-21(18-24(23)37-27(32)14-12-10-7-2)17-22(29)28(33)35-20(5)19(4)34-25(30)8-3/h15-16,18-20,22H,6-14,17,29H2,1-5H3/t19-,20-,22-/m0/s1 |
| InChIKey | DCFLXYROWKBILK-ONTIZHBOSA-N |
| XLogP | 4.80 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|