C31H49NO10 — CID 66946926
[(3S)-3-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate (PubChem CID 66946926) has the molecular formula C31H49NO10 and a molecular weight of 595.73 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate |
|---|---|
| PubChem CID | 66946926 |
| Molecular Formula | C31H49NO10 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)OC(C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c1 |
| InChI | InChI=1S/C31H49NO10/c1-10-11-12-13-26(33)39-20(2)21(3)40-27(34)23(32)16-22-14-15-24(41-28(35)37-18-30(4,5)6)25(17-22)42-29(36)38-19-31(7,8)9/h14-15,17,20-21,23H,10-13,16,18-19,32H2,1-9H3/t20?,21-,23-/m0/s1 |
| InChIKey | PAICRVIAYDZNMH-ZXNYFWILSA-N |
| XLogP | 6.12 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|