C30H47NO10 — CID 90911495
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] pentanoate (PubChem CID 90911495) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] pentanoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] pentanoate |
|---|---|
| PubChem CID | 90911495 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] pentanoate |
| SMILES | CCCCCOC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)[C@H](C)OC(=O)CCCC)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C30H47NO10/c1-6-9-12-17-36-29(34)40-25-16-15-23(20-26(25)41-30(35)37-18-13-10-7-2)19-24(31)28(33)39-22(5)21(4)38-27(32)14-11-8-3/h15-16,20-22,24H,6-14,17-19,31H2,1-5H3/t21-,22-,24-/m0/s1 |
| InChIKey | HTQSBKWPTJGQCT-FIXSFTCYSA-N |
| XLogP | 6.02 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|