C31H49NO10 — CID 66950024
[(3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate (PubChem CID 66950024) has the molecular formula C31H49NO10 and a molecular weight of 595.73 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate |
|---|---|
| PubChem CID | 66950024 |
| Molecular Formula | C31H49NO10 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] hexanoate |
| SMILES | CCCCCOC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)C(C)OC(=O)CCCCC)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C31H49NO10/c1-6-9-12-15-28(33)39-22(4)23(5)40-29(34)25(32)20-24-16-17-26(41-30(35)37-18-13-10-7-2)27(21-24)42-31(36)38-19-14-11-8-3/h16-17,21-23,25H,6-15,18-20,32H2,1-5H3/t22?,23-,25-/m0/s1 |
| InChIKey | OWMMXYNTYYMIHJ-HPZMQGABSA-N |
| XLogP | 6.41 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|