C22H33NO6 — CID 85471444
[4-[(2S)-2-amino-3-oxo-3-propan-2-yloxypropyl]-2-pentanoyloxyphenyl] pentanoate (PubChem CID 85471444) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-propan-2-yloxypropyl]-2-pentanoyloxyphenyl] pentanoate.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-propan-2-yloxypropyl]-2-pentanoyloxyphenyl] pentanoate |
|---|---|
| PubChem CID | 85471444 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-propan-2-yloxypropyl]-2-pentanoyloxyphenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(C[C@H](N)C(=O)OC(C)C)cc1OC(=O)CCCC |
| InChI | InChI=1S/C22H33NO6/c1-5-7-9-20(24)28-18-12-11-16(13-17(23)22(26)27-15(3)4)14-19(18)29-21(25)10-8-6-2/h11-12,14-15,17H,5-10,13,23H2,1-4H3/t17-/m0/s1 |
| InChIKey | ZYNRRGCXPVONSZ-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|