C29H45NO8 — CID 66946147
[(3S)-3-[(2S)-2-amino-3-[3,4-di(pentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2,2-dimethylbutanoate (PubChem CID 66946147) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is [(3S)-3-[(2S)-2-amino-3-[3,4-di(pentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [(3S)-3-[(2S)-2-amino-3-[3,4-di(pentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 66946147 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [(3S)-3-[(2S)-2-amino-3-[3,4-di(pentanoyloxy)phenyl]propanoyl]oxybutan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)C(C)OC(=O)C(C)(C)CC)cc1OC(=O)CCCC |
| InChI | InChI=1S/C29H45NO8/c1-8-11-13-25(31)37-23-16-15-21(18-24(23)38-26(32)14-12-9-2)17-22(30)27(33)35-19(4)20(5)36-28(34)29(6,7)10-3/h15-16,18-20,22H,8-14,17,30H2,1-7H3/t19-,20?,22-/m0/s1 |
| InChIKey | VPTLEKQSNWIZSI-DJJOMLBWSA-N |
| XLogP | 5.05 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|