C20H27NO10 — CID 91353554
[(2S)-2-[(2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 2-methylpropanoate (PubChem CID 91353554) has the molecular formula C20H27NO10 and a molecular weight of 441.43 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 91353554 |
| Molecular Formula | C20H27NO10 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(methoxycarbonyloxy)phenyl]propanoyl]oxypropyl] 2-methylpropanoate |
| SMILES | COC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)COC(=O)C(C)C)cc1OC(=O)OC |
| InChI | InChI=1S/C20H27NO10/c1-11(2)17(22)28-10-12(3)29-18(23)14(21)8-13-6-7-15(30-19(24)26-4)16(9-13)31-20(25)27-5/h6-7,9,11-12,14H,8,10,21H2,1-5H3/t12-,14-/m0/s1 |
| InChIKey | ZHQSUVFJSHJACG-JSGCOSHPSA-N |
| XLogP | 1.98 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|