C24H35NO8 — CID 91479406
[4-[(2S)-2-amino-3-[(2S)-2-(2-methylpropanoyloxy)propoxy]-3-oxopropyl]-2-butanoyloxyphenyl] butanoate (PubChem CID 91479406) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-[(2S)-2-(2-methylpropanoyloxy)propoxy]-3-oxopropyl]-2-butanoyloxyphenyl] butanoate.
| Compound Name | [4-[(2S)-2-amino-3-[(2S)-2-(2-methylpropanoyloxy)propoxy]-3-oxopropyl]-2-butanoyloxyphenyl] butanoate |
|---|---|
| PubChem CID | 91479406 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | [4-[(2S)-2-amino-3-[(2S)-2-(2-methylpropanoyloxy)propoxy]-3-oxopropyl]-2-butanoyloxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)C(C)C)cc1OC(=O)CCC |
| InChI | InChI=1S/C24H35NO8/c1-6-8-21(26)32-19-11-10-17(13-20(19)33-22(27)9-7-2)12-18(25)24(29)30-14-16(5)31-23(28)15(3)4/h10-11,13,15-16,18H,6-9,12,14,25H2,1-5H3/t16-,18-/m0/s1 |
| InChIKey | OFYPFNRBHLZRID-WMZOPIPTSA-N |
| XLogP | 3.10 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|