C28H43NO10 — CID 91255623
[(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 2-methylpropanoate (PubChem CID 91255623) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 2-methylpropanoate.
| Compound Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 91255623 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 2-methylpropanoate |
| SMILES | CCC(C)(C)OC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)C(C)C)cc1OC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C28H43NO10/c1-10-27(6,7)38-25(32)36-21-13-12-19(15-22(21)37-26(33)39-28(8,9)11-2)14-20(29)24(31)34-16-18(5)35-23(30)17(3)4/h12-13,15,17-18,20H,10-11,14,16,29H2,1-9H3/t18-,20-/m0/s1 |
| InChIKey | CWJPTXILHMDYRO-ICSRJNTNSA-N |
| XLogP | 5.10 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|