C30H47NO11 — CID 66946424
[(2S)-1-(2-methylbutan-2-yloxycarbonyloxy)propan-2-yl] (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoate (PubChem CID 66946424) has the molecular formula C30H47NO11 and a molecular weight of 597.70 g/mol. Its IUPAC name is [(2S)-1-(2-methylbutan-2-yloxycarbonyloxy)propan-2-yl] (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S)-1-(2-methylbutan-2-yloxycarbonyloxy)propan-2-yl] (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 66946424 |
| Molecular Formula | C30H47NO11 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | [(2S)-1-(2-methylbutan-2-yloxycarbonyloxy)propan-2-yl] (2S)-2-amino-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]propanoate |
| SMILES | CCC(C)(C)OC(=O)OC[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c1 |
| InChI | InChI=1S/C30H47NO11/c1-11-30(9,10)42-27(35)36-16-19(2)39-24(32)21(31)14-20-12-13-22(40-25(33)37-17-28(3,4)5)23(15-20)41-26(34)38-18-29(6,7)8/h12-13,15,19,21H,11,14,16-18,31H2,1-10H3/t19-,21-/m0/s1 |
| InChIKey | VUZVNZONHSUSPD-FPOVZHCZSA-N |
| XLogP | 5.95 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|