C26H39NO8 — CID 91147053
[(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] 3-methylpentanoate (PubChem CID 91147053) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] 3-methylpentanoate.
| Compound Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] 3-methylpentanoate |
|---|---|
| PubChem CID | 91147053 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [(2S)-2-[(2S)-2-amino-3-[3,4-bis(2-methylpropanoyloxy)phenyl]propanoyl]oxypropyl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OC[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C26H39NO8/c1-8-17(6)11-23(28)32-14-18(7)33-26(31)20(27)12-19-9-10-21(34-24(29)15(2)3)22(13-19)35-25(30)16(4)5/h9-10,13,15-18,20H,8,11-12,14,27H2,1-7H3/t17?,18-,20-/m0/s1 |
| InChIKey | PROFFEZBWWDXII-WSTRIDTPSA-N |
| XLogP | 3.59 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|