C31H49NO10 — CID 90966371
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate (PubChem CID 90966371) has the molecular formula C31H49NO10 and a molecular weight of 595.73 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate |
|---|---|
| PubChem CID | 90966371 |
| Molecular Formula | C31H49NO10 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1 |
| InChI | InChI=1S/C31H49NO10/c1-11-19(6)14-28(33)37-22(9)23(10)38-29(34)25(32)15-24-12-13-26(41-30(35)39-20(7)17(2)3)27(16-24)42-31(36)40-21(8)18(4)5/h12-13,16-23,25H,11,14-15,32H2,1-10H3/t19?,20?,21?,22-,23-,25-/m0/s1 |
| InChIKey | YPPDEQCEDVNCGI-MLHDWPHVSA-N |
| XLogP | 5.98 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|