C29H45NO9 — CID 66948696
(4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid (PubChem CID 66948696) has the molecular formula C29H45NO9 and a molecular weight of 551.68 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66948696 |
| Molecular Formula | C29H45NO9 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid |
| SMILES | CCC(C)OC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)C(C)(C)CC)c(OC(=O)C(C)(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C29H45NO9/c1-10-18(4)36-26(35)37-19(5)16-29(30,23(31)32)17-20-13-14-21(38-24(33)27(6,7)11-2)22(15-20)39-25(34)28(8,9)12-3/h13-15,18-19H,10-12,16-17,30H2,1-9H3,(H,31,32)/t18?,19-,29?/m0/s1 |
| InChIKey | JJCZJROWNFHYCS-WVXSNEISSA-N |
| XLogP | 5.42 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|