C31H47NO8 — CID 66943528
(4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid (PubChem CID 66943528) has the molecular formula C31H47NO8 and a molecular weight of 561.72 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66943528 |
| Molecular Formula | C31H47NO8 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)C2CCCCC2)C(=O)O)cc1OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C31H47NO8/c1-8-29(4,5)27(36)39-23-16-15-21(17-24(23)40-28(37)30(6,7)9-2)19-31(32,26(34)35)18-20(3)38-25(33)22-13-11-10-12-14-22/h15-17,20,22H,8-14,18-19,32H2,1-7H3,(H,34,35)/t20-,31?/m0/s1 |
| InChIKey | KTYLMAIOGGJBKD-MFYZJFEASA-N |
| XLogP | 5.60 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|