C22H31NO9 — CID 66944826
(4S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid (PubChem CID 66944826) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is (4S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66944826 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (4S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylbutan-2-yloxycarbonyloxy)pentanoic acid |
| SMILES | CCC(C)(C)OC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)O |
| InChI | InChI=1S/C22H31NO9/c1-7-21(5,6)32-20(28)29-13(2)11-22(23,19(26)27)12-16-8-9-17(30-14(3)24)18(10-16)31-15(4)25/h8-10,13H,7,11-12,23H2,1-6H3,(H,26,27)/t13-,22?/m0/s1 |
| InChIKey | FRYHSBFIKZPWAK-JHAYDQECSA-N |
| XLogP | 2.98 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|