C21H29NO9 — CID 66948989
(4S)-2-amino-4-butoxycarbonyloxy-2-[(3,4-diacetyloxyphenyl)methyl]pentanoic acid (PubChem CID 66948989) has the molecular formula C21H29NO9 and a molecular weight of 439.46 g/mol. Its IUPAC name is (4S)-2-amino-4-butoxycarbonyloxy-2-[(3,4-diacetyloxyphenyl)methyl]pentanoic acid.
| Compound Name | (4S)-2-amino-4-butoxycarbonyloxy-2-[(3,4-diacetyloxyphenyl)methyl]pentanoic acid |
|---|---|
| PubChem CID | 66948989 |
| Molecular Formula | C21H29NO9 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (4S)-2-amino-4-butoxycarbonyloxy-2-[(3,4-diacetyloxyphenyl)methyl]pentanoic acid |
| SMILES | CCCCOC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)O |
| InChI | InChI=1S/C21H29NO9/c1-5-6-9-28-20(27)29-13(2)11-21(22,19(25)26)12-16-7-8-17(30-14(3)23)18(10-16)31-15(4)24/h7-8,10,13H,5-6,9,11-12,22H2,1-4H3,(H,25,26)/t13-,21?/m0/s1 |
| InChIKey | AKDZIELETXSTFE-JRTLGTJJSA-N |
| XLogP | 2.59 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|