C28H43NO11 — CID 66950271
(4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoic acid (PubChem CID 66950271) has the molecular formula C28H43NO11 and a molecular weight of 569.65 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66950271 |
| Molecular Formula | C28H43NO11 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoic acid |
| SMILES | CCCCCOC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1)C(=O)O |
| InChI | InChI=1S/C28H43NO11/c1-7-8-9-12-35-25(32)38-20(6)14-28(29,24(30)31)15-21-10-11-22(39-26(33)36-16-18(2)3)23(13-21)40-27(34)37-17-19(4)5/h10-11,13,18-20H,7-9,12,14-17,29H2,1-6H3,(H,30,31)/t20-,28?/m0/s1 |
| InChIKey | MLXDKTVXOHFOIX-CQHAJPFMSA-N |
| XLogP | 5.48 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|