C27H41NO10 — CID 68795083
(2S,4S)-2-amino-2-[[3,4-bis(butoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutanoyloxy)pentanoic acid (PubChem CID 68795083) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is (2S,4S)-2-amino-2-[[3,4-bis(butoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutanoyloxy)pentanoic acid.
| Compound Name | (2S,4S)-2-amino-2-[[3,4-bis(butoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 68795083 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (2S,4S)-2-amino-2-[[3,4-bis(butoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutanoyloxy)pentanoic acid |
| SMILES | CCCCOC(=O)Oc1ccc(C[C@](N)(C[C@H](C)OC(=O)CC(C)C)C(=O)O)cc1OC(=O)OCCCC |
| InChI | InChI=1S/C27H41NO10/c1-6-8-12-34-25(32)37-21-11-10-20(15-22(21)38-26(33)35-13-9-7-2)17-27(28,24(30)31)16-19(5)36-23(29)14-18(3)4/h10-11,15,18-19H,6-9,12-14,16-17,28H2,1-5H3,(H,30,31)/t19-,27+/m0/s1 |
| InChIKey | ZUZVOMZSHOFTNR-UZTOHYMASA-N |
| XLogP | 5.01 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|