C22H31NO10 — CID 66949881
(4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-butanoyloxypentanoic acid (PubChem CID 66949881) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-butanoyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-butanoyloxypentanoic acid |
|---|---|
| PubChem CID | 66949881 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-butanoyloxypentanoic acid |
| SMILES | CCCC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)OCC)c(OC(=O)OCC)c1)C(=O)O |
| InChI | InChI=1S/C22H31NO10/c1-5-8-18(24)31-14(4)12-22(23,19(25)26)13-15-9-10-16(32-20(27)29-6-2)17(11-15)33-21(28)30-7-3/h9-11,14H,5-8,12-13,23H2,1-4H3,(H,25,26)/t14-,22?/m0/s1 |
| InChIKey | ZUFLYOQRFAKPIX-XLEXHMCLSA-N |
| XLogP | 3.20 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|