C25H35NO11 — CID 66948291
(4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid (PubChem CID 66948291) has the molecular formula C25H35NO11 and a molecular weight of 525.55 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66948291 |
| Molecular Formula | C25H35NO11 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid |
| SMILES | CCOC(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)OC2CCCCC2)C(=O)O)cc1OC(=O)OCC |
| InChI | InChI=1S/C25H35NO11/c1-4-32-22(29)36-19-12-11-17(13-20(19)37-23(30)33-5-2)15-25(26,21(27)28)14-16(3)34-24(31)35-18-9-7-6-8-10-18/h11-13,16,18H,4-10,14-15,26H2,1-3H3,(H,27,28)/t16-,25?/m0/s1 |
| InChIKey | INHONFHPUOXXFE-YPHZTSLFSA-N |
| XLogP | 4.35 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|