C29H43NO10 — CID 66947384
(4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid (PubChem CID 66947384) has the molecular formula C29H43NO10 and a molecular weight of 565.66 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66947384 |
| Molecular Formula | C29H43NO10 |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(cyclohexanecarbonyloxy)pentanoic acid |
| SMILES | CC(C)COC(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)C2CCCCC2)C(=O)O)cc1OC(=O)OCC(C)C |
| InChI | InChI=1S/C29H43NO10/c1-18(2)16-36-27(34)39-23-12-11-21(13-24(23)40-28(35)37-17-19(3)4)15-29(30,26(32)33)14-20(5)38-25(31)22-9-7-6-8-10-22/h11-13,18-20,22H,6-10,14-17,30H2,1-5H3,(H,32,33)/t20-,29?/m0/s1 |
| InChIKey | BCBYRZWOHVVKOZ-OORIHMLWSA-N |
| XLogP | 5.26 |
| TPSA | 160.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|