C31H47NO9 — CID 66945559
(4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid (PubChem CID 66945559) has the molecular formula C31H47NO9 and a molecular weight of 577.72 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66945559 |
| Molecular Formula | C31H47NO9 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-cyclohexyloxycarbonyloxypentanoic acid |
| SMILES | CC(C)CCC(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)OC2CCCCC2)C(=O)O)cc1OC(=O)CCC(C)C |
| InChI | InChI=1S/C31H47NO9/c1-20(2)11-15-27(33)40-25-14-13-23(17-26(25)41-28(34)16-12-21(3)4)19-31(32,29(35)36)18-22(5)38-30(37)39-24-9-7-6-8-10-24/h13-14,17,20-22,24H,6-12,15-16,18-19,32H2,1-5H3,(H,35,36)/t22-,31?/m0/s1 |
| InChIKey | GBSITJNULASTPH-DEUJGTPJSA-N |
| XLogP | 5.96 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|