C30H47NO9 — CID 66950398
methyl (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)pentanoate (PubChem CID 66950398) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is methyl (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)pentanoate.
| Compound Name | methyl (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)pentanoate |
|---|---|
| PubChem CID | 66950398 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | methyl (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)pentanoate |
| SMILES | COC(=O)C(N)(Cc1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1)C[C@H](C)OC(=O)OCC(C)C |
| InChI | InChI=1S/C30H47NO9/c1-19(2)9-13-26(32)39-24-12-11-23(15-25(24)40-27(33)14-10-20(3)4)17-30(31,28(34)36-8)16-22(7)38-29(35)37-18-21(5)6/h11-12,15,19-22H,9-10,13-14,16-18,31H2,1-8H3/t22-,30?/m0/s1 |
| InChIKey | YIRJFSGLYXSGHT-VUUJKMBOSA-N |
| XLogP | 5.37 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|