C29H45NO11 — CID 66952194
methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-[(2S)-pentan-2-yl]oxycarbonyloxypentanoate (PubChem CID 66952194) has the molecular formula C29H45NO11 and a molecular weight of 583.68 g/mol. Its IUPAC name is methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-[(2S)-pentan-2-yl]oxycarbonyloxypentanoate.
| Compound Name | methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-[(2S)-pentan-2-yl]oxycarbonyloxypentanoate |
|---|---|
| PubChem CID | 66952194 |
| Molecular Formula | C29H45NO11 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-[(2S)-pentan-2-yl]oxycarbonyloxypentanoate |
| SMILES | CCC[C@H](C)OC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C29H45NO11/c1-9-10-20(6)38-28(34)39-21(7)14-29(30,25(31)35-8)15-22-11-12-23(40-26(32)36-16-18(2)3)24(13-22)41-27(33)37-17-19(4)5/h11-13,18-21H,9-10,14-17,30H2,1-8H3/t20-,21-,29?/m0/s1 |
| InChIKey | PHQOBVRFWYZGRV-RLTOAWKYSA-N |
| XLogP | 5.56 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|