C29H45NO9 — CID 66945471
methyl (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2-methylbutoxycarbonyloxy)pentanoate (PubChem CID 66945471) has the molecular formula C29H45NO9 and a molecular weight of 551.68 g/mol. Its IUPAC name is methyl (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2-methylbutoxycarbonyloxy)pentanoate.
| Compound Name | methyl (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2-methylbutoxycarbonyloxy)pentanoate |
|---|---|
| PubChem CID | 66945471 |
| Molecular Formula | C29H45NO9 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | methyl (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2-methylbutoxycarbonyloxy)pentanoate |
| SMILES | CCC(C)COC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)CC(C)C)c(OC(=O)CC(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C29H45NO9/c1-9-20(6)17-36-28(34)37-21(7)15-29(30,27(33)35-8)16-22-10-11-23(38-25(31)12-18(2)3)24(14-22)39-26(32)13-19(4)5/h10-11,14,18-21H,9,12-13,15-17,30H2,1-8H3/t20?,21-,29?/m0/s1 |
| InChIKey | JPXFYJYXJSSDFT-WEFOENGGSA-N |
| XLogP | 4.98 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|