C31H49NO8 — CID 66947001
methyl (2S)-2-amino-2-[[3,4-di(hexanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate (PubChem CID 66947001) has the molecular formula C31H49NO8 and a molecular weight of 563.73 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-di(hexanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-di(hexanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate |
|---|---|
| PubChem CID | 66947001 |
| Molecular Formula | C31H49NO8 |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-di(hexanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate |
| SMILES | CCCCCC(=O)Oc1ccc(C[C@](N)(CC(C)OC(=O)CCC(C)C)C(=O)OC)cc1OC(=O)CCCCC |
| InChI | InChI=1S/C31H49NO8/c1-7-9-11-13-27(33)39-25-17-16-24(19-26(25)40-28(34)14-12-10-8-2)21-31(32,30(36)37-6)20-23(5)38-29(35)18-15-22(3)4/h16-17,19,22-23H,7-15,18,20-21,32H2,1-6H3/t23?,31-/m1/s1 |
| InChIKey | BFCJTFHNRZPBAB-ORLYWQOISA-N |
| XLogP | 5.83 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|