C30H47NO8 — CID 66947401
(4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(3-methylpentanoyloxy)pentanoic acid (PubChem CID 66947401) has the molecular formula C30H47NO8 and a molecular weight of 549.71 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(3-methylpentanoyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(3-methylpentanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66947401 |
| Molecular Formula | C30H47NO8 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(4-methylpentanoyloxy)phenyl]methyl]-4-(3-methylpentanoyloxy)pentanoic acid |
| SMILES | CCC(C)CC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1)C(=O)O |
| InChI | InChI=1S/C30H47NO8/c1-8-21(6)15-28(34)37-22(7)17-30(31,29(35)36)18-23-11-12-24(38-26(32)13-9-19(2)3)25(16-23)39-27(33)14-10-20(4)5/h11-12,16,19-22H,8-10,13-15,17-18,31H2,1-7H3,(H,35,36)/t21?,22-,30?/m0/s1 |
| InChIKey | IXYGFEDCONNYJX-YLVHXASLSA-N |
| XLogP | 5.45 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|