C29H45NO9 — CID 66947448
(4S)-2-amino-2-[[3,4-bis(3-methylpentanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid (PubChem CID 66947448) has the molecular formula C29H45NO9 and a molecular weight of 551.68 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(3-methylpentanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(3-methylpentanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66947448 |
| Molecular Formula | C29H45NO9 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(3-methylpentanoyloxy)phenyl]methyl]-4-butan-2-yloxycarbonyloxypentanoic acid |
| SMILES | CCC(C)CC(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)OC(C)CC)C(=O)O)cc1OC(=O)CC(C)CC |
| InChI | InChI=1S/C29H45NO9/c1-8-18(4)13-25(31)38-23-12-11-22(15-24(23)39-26(32)14-19(5)9-2)17-29(30,27(33)34)16-21(7)37-28(35)36-20(6)10-3/h11-12,15,18-21H,8-10,13-14,16-17,30H2,1-7H3,(H,33,34)/t18?,19?,20?,21-,29?/m0/s1 |
| InChIKey | GAYZTWALDSQMIH-CKMRVLJOSA-N |
| XLogP | 5.42 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|