C20H27NO9 — CID 66949307
(4S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-methoxycarbonyloxypentanoic acid (PubChem CID 66949307) has the molecular formula C20H27NO9 and a molecular weight of 425.43 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-methoxycarbonyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-methoxycarbonyloxypentanoic acid |
|---|---|
| PubChem CID | 66949307 |
| Molecular Formula | C20H27NO9 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-methoxycarbonyloxypentanoic acid |
| SMILES | CCC(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)OC)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C20H27NO9/c1-5-16(22)29-14-8-7-13(9-15(14)30-17(23)6-2)11-20(21,18(24)25)10-12(3)28-19(26)27-4/h7-9,12H,5-6,10-11,21H2,1-4H3,(H,24,25)/t12-,20?/m0/s1 |
| InChIKey | NKCBIXCJTWXMRV-SVZXGPMESA-N |
| XLogP | 2.20 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|