C27H41NO8 — CID 66943801
(4S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-propanoyloxypentanoic acid (PubChem CID 66943801) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-propanoyloxypentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-propanoyloxypentanoic acid |
|---|---|
| PubChem CID | 66943801 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-propanoyloxypentanoic acid |
| SMILES | CCCC(C)C(=O)Oc1ccc(CC(N)(C[C@H](C)OC(=O)CC)C(=O)O)cc1OC(=O)C(C)CCC |
| InChI | InChI=1S/C27H41NO8/c1-7-10-17(4)24(30)35-21-13-12-20(14-22(21)36-25(31)18(5)11-8-2)16-27(28,26(32)33)15-19(6)34-23(29)9-3/h12-14,17-19H,7-11,15-16,28H2,1-6H3,(H,32,33)/t17?,18?,19-,27?/m0/s1 |
| InChIKey | SLBCRXOUIDKKMF-BHOXIDQHSA-N |
| XLogP | 4.43 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|