C30H47NO8 — CID 66944269
(4S)-2-amino-2-[[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]methyl]-4-(2-methylpentanoyloxy)pentanoic acid (PubChem CID 66944269) has the molecular formula C30H47NO8 and a molecular weight of 549.71 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]methyl]-4-(2-methylpentanoyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]methyl]-4-(2-methylpentanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66944269 |
| Molecular Formula | C30H47NO8 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(3,3-dimethylbutanoyloxy)phenyl]methyl]-4-(2-methylpentanoyloxy)pentanoic acid |
| SMILES | CCCC(C)C(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)CC(C)(C)C)c(OC(=O)CC(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C30H47NO8/c1-10-11-19(2)26(34)37-20(3)15-30(31,27(35)36)16-21-12-13-22(38-24(32)17-28(4,5)6)23(14-21)39-25(33)18-29(7,8)9/h12-14,19-20H,10-11,15-18,31H2,1-9H3,(H,35,36)/t19?,20-,30?/m0/s1 |
| InChIKey | NNJRUZJBNIQHQP-NFQYFPACSA-N |
| XLogP | 5.45 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|