C23H33NO8 — CID 66950913
methyl (2S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylpentanoyloxy)pentanoate (PubChem CID 66950913) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylpentanoyloxy)pentanoate.
| Compound Name | methyl (2S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylpentanoyloxy)pentanoate |
|---|---|
| PubChem CID | 66950913 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | methyl (2S)-2-amino-2-[(3,4-diacetyloxyphenyl)methyl]-4-(2-methylpentanoyloxy)pentanoate |
| SMILES | CCCC(C)C(=O)OC(C)C[C@@](N)(Cc1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)OC |
| InChI | InChI=1S/C23H33NO8/c1-7-8-14(2)21(27)30-15(3)12-23(24,22(28)29-6)13-18-9-10-19(31-16(4)25)20(11-18)32-17(5)26/h9-11,14-15H,7-8,12-13,24H2,1-6H3/t14?,15?,23-/m1/s1 |
| InChIKey | DBCTXBIKWQCDBI-CKBDLISKSA-N |
| XLogP | 2.71 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|