C29H45NO8 — CID 66949394
methyl (2S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)pentanoate (PubChem CID 66949394) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)pentanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)pentanoate |
|---|---|
| PubChem CID | 66949394 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylpentanoyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)pentanoate |
| SMILES | CCCC(C)C(=O)Oc1ccc(C[C@](N)(CC(C)OC(=O)C(C)C)C(=O)OC)cc1OC(=O)C(C)CCC |
| InChI | InChI=1S/C29H45NO8/c1-9-11-19(5)26(32)37-23-14-13-22(15-24(23)38-27(33)20(6)12-10-2)17-29(30,28(34)35-8)16-21(7)36-25(31)18(3)4/h13-15,18-21H,9-12,16-17,30H2,1-8H3/t19?,20?,21?,29-/m1/s1 |
| InChIKey | UPSMBTNKTGTDAJ-ZPOAGDITSA-N |
| XLogP | 4.76 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|