C25H37NO8 — CID 66951410
methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate (PubChem CID 66951410) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate |
|---|---|
| PubChem CID | 66951410 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-(4-methylpentanoyloxy)pentanoate |
| SMILES | CCC(=O)Oc1ccc(C[C@](N)(CC(C)OC(=O)CCC(C)C)C(=O)OC)cc1OC(=O)CC |
| InChI | InChI=1S/C25H37NO8/c1-7-21(27)33-19-11-10-18(13-20(19)34-22(28)8-2)15-25(26,24(30)31-6)14-17(5)32-23(29)12-9-16(3)4/h10-11,13,16-17H,7-9,12,14-15,26H2,1-6H3/t17?,25-/m1/s1 |
| InChIKey | YRHCESDHJNYEBO-DNIBEGIYSA-N |
| XLogP | 3.49 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|