C31H47NO9 — CID 66948318
(2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-cyclohexyloxycarbonyloxy-2-(propan-2-ylamino)propanoic acid (PubChem CID 66948318) has the molecular formula C31H47NO9 and a molecular weight of 577.72 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-cyclohexyloxycarbonyloxy-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-cyclohexyloxycarbonyloxy-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66948318 |
| Molecular Formula | C31H47NO9 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-cyclohexyloxycarbonyloxy-2-(propan-2-ylamino)propanoic acid |
| SMILES | CC(C)CCC(=O)Oc1ccc(C[C@](NC(C)C)(OC(=O)OC2CCCCC2)C(=O)O)cc1OC(=O)CCC(C)C |
| InChI | InChI=1S/C31H47NO9/c1-20(2)12-16-27(33)39-25-15-14-23(18-26(25)40-28(34)17-13-21(3)4)19-31(29(35)36,32-22(5)6)41-30(37)38-24-10-8-7-9-11-24/h14-15,18,20-22,24,32H,7-13,16-17,19H2,1-6H3,(H,35,36)/t31-/m0/s1 |
| InChIKey | UBWPYXXDVLHPPD-HKBQPEDESA-N |
| XLogP | 6.18 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|