C29H45NO9 — CID 66949733
(2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid (PubChem CID 66949733) has the molecular formula C29H45NO9 and a molecular weight of 551.68 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid.
| Compound Name | (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid |
|---|---|
| PubChem CID | 66949733 |
| Molecular Formula | C29H45NO9 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (2S)-3-[3,4-bis(4-methylpentanoyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid |
| SMILES | CCC(C)N[C@@](Cc1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1)(OC(=O)OC(C)C)C(=O)O |
| InChI | InChI=1S/C29H45NO9/c1-9-21(8)30-29(27(33)34,39-28(35)36-20(6)7)17-22-12-13-23(37-25(31)14-10-18(2)3)24(16-22)38-26(32)15-11-19(4)5/h12-13,16,18-21,30H,9-11,14-15,17H2,1-8H3,(H,33,34)/t21?,29-/m0/s1 |
| InChIKey | LYHPUOHQNDXUJF-TXMUIZFDSA-N |
| XLogP | 5.64 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|